6-chloro-2-(2,4-dimethoxyphenyl)quinoline-4-carboxylic acid

C18H14ClNO4 — CID 138811121

IUPAC6-chloro-2-(2,4-dimethoxyphenyl)quinoline-4-carboxylic acid
SMILESCOc1ccc(-c2cc(C(=O)O)c3cc(Cl)ccc3n2)c(OC)c1
InChIInChI=1S/C18H14ClNO4/c1-23-11-4-5-12(17(8-11)24-2)16-9-14(18(21)22)13-7-10(19)3-6-15(13)20-16/h3-9H,1-2H3,(H,21,22)
InChIKeyJACSVYZWFNGTKN-UHFFFAOYSA-N
MW343.77 g/mol
LogP4.27
Rot. Bonds4

About 6-chloro-2-(2,4-dimethoxyphenyl)quinoline-4-carboxylic acid

6-chloro-2-(2,4-dimethoxyphenyl)quinoline-4-carboxylic acid (PubChem CID 138811121) has the molecular formula C18H14ClNO4 and a molecular weight of 343.77 g/mol. Its IUPAC name is 6-chloro-2-(2,4-dimethoxyphenyl)quinoline-4-carboxylic acid.

Molecular Properties

Compound Name6-chloro-2-(2,4-dimethoxyphenyl)quinoline-4-carboxylic acid
PubChem CID138811121
Molecular FormulaC18H14ClNO4
Molecular Weight343.77 g/mol
Exact Mass343.06
IUPAC Name6-chloro-2-(2,4-dimethoxyphenyl)quinoline-4-carboxylic acid
SMILESCOc1ccc(-c2cc(C(=O)O)c3cc(Cl)ccc3n2)c(OC)c1
InChIInChI=1S/C18H14ClNO4/c1-23-11-4-5-12(17(8-11)24-2)16-9-14(18(21)22)13-7-10(19)3-6-15(13)20-16/h3-9H,1-2H3,(H,21,22)
InChIKeyJACSVYZWFNGTKN-UHFFFAOYSA-N
XLogP4.27
TPSA68.65 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500343.77
LogP ≤ 54.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 6-chloro-2-(2,4-dimethoxyphenyl)quinoline-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-chloro-2-(2,4-dimethoxyphenyl)quinoline-4-carboxylic acid?
The IUPAC name of 6-chloro-2-(2,4-dimethoxyphenyl)quinoline-4-carboxylic acid (CID 138811121) is 6-chloro-2-(2,4-dimethoxyphenyl)quinoline-4-carboxylic acid.
What is the SMILES notation for 6-chloro-2-(2,4-dimethoxyphenyl)quinoline-4-carboxylic acid?
The canonical SMILES for 6-chloro-2-(2,4-dimethoxyphenyl)quinoline-4-carboxylic acid is COc1ccc(-c2cc(C(=O)O)c3cc(Cl)ccc3n2)c(OC)c1.
What is the InChIKey of 6-chloro-2-(2,4-dimethoxyphenyl)quinoline-4-carboxylic acid?
The InChIKey is JACSVYZWFNGTKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14ClNO4/c1-23-11-4-5-12(17(8-11)24-2)16-9-14(18(21)22)13-7-10(19)3-6-15(13)20-16/h3-9H,1-2H3,(H,21,22).
What are the key properties of 6-chloro-2-(2,4-dimethoxyphenyl)quinoline-4-carboxylic acid?
6-chloro-2-(2,4-dimethoxyphenyl)quinoline-4-carboxylic acid has a molecular weight of 343.77 g/mol, XLogP of 4.27, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-(2,4-dimethoxyphenyl)quinoline-4-carboxylic acid is sourced from PubChem (CID 138811121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).