C19H13BrN2O3S2 — CID 1388338
6-bromo-3-[3-(4-ethoxyphenyl)-4-hydroxy-2-sulfanylidene-1,3-thiazol-5-yl]indol-2-one (PubChem CID 1388338) has the molecular formula C19H13BrN2O3S2 and a molecular weight of 461.36 g/mol. Its IUPAC name is 6-bromo-3-[3-(4-ethoxyphenyl)-4-hydroxy-2-sulfanylidene-1,3-thiazol-5-yl]indol-2-one.
| Compound Name | 6-bromo-3-[3-(4-ethoxyphenyl)-4-hydroxy-2-sulfanylidene-1,3-thiazol-5-yl]indol-2-one |
|---|---|
| PubChem CID | 1388338 |
| Molecular Formula | C19H13BrN2O3S2 |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 459.96 |
| IUPAC Name | 6-bromo-3-[3-(4-ethoxyphenyl)-4-hydroxy-2-sulfanylidene-1,3-thiazol-5-yl]indol-2-one |
| SMILES | CCOc1ccc(-n2c(O)c(C3=c4ccc(Br)cc4=NC3=O)sc2=S)cc1 |
| InChI | InChI=1S/C19H13BrN2O3S2/c1-2-25-12-6-4-11(5-7-12)22-18(24)16(27-19(22)26)15-13-8-3-10(20)9-14(13)21-17(15)23/h3-9,24H,2H2,1H3 |
| InChIKey | ROEWMEAOYMSTAS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|