About (2S)-2-aminopentanal
(2S)-2-aminopentanal (PubChem CID 138857465) has the molecular formula C5H10NO-
and a molecular weight of 100.14 g/mol. Its IUPAC name is (2S)-2-aminopentanal.
Molecular Properties
| Compound Name | (2S)-2-aminopentanal |
| PubChem CID | 138857465 |
| Molecular Formula | C5H10NO- |
| Molecular Weight | 100.14 g/mol |
| Exact Mass | 100.08 |
| IUPAC Name | (2S)-2-aminopentanal |
| SMILES | [CH2-]CC[C@H](N)C=O |
| InChI | InChI=1S/C5H10NO/c1-2-3-5(6)4-7/h4-5H,1-3,6H2/q-1/t5-/m0/s1 |
| InChIKey | FIRMDRXNYSFAAS-YFKPBYRVSA-N |
| XLogP | 0.13 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.14 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-aminopentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminopentanal?
The IUPAC name of (2S)-2-aminopentanal (CID 138857465) is (2S)-2-aminopentanal.
What is the SMILES notation for (2S)-2-aminopentanal?
The canonical SMILES for (2S)-2-aminopentanal is [CH2-]CC[C@H](N)C=O.
What is the InChIKey of (2S)-2-aminopentanal?
The InChIKey is FIRMDRXNYSFAAS-YFKPBYRVSA-N. The full InChI is InChI=1S/C5H10NO/c1-2-3-5(6)4-7/h4-5H,1-3,6H2/q-1/t5-/m0/s1.
What are the key properties of (2S)-2-aminopentanal?
(2S)-2-aminopentanal has a molecular weight of 100.14 g/mol, XLogP of 0.13, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminopentanal is sourced from PubChem (CID 138857465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).