About (2S)-2-aminobutanal
(2S)-2-aminobutanal (PubChem CID 138857479) has the molecular formula C4H8NO-
and a molecular weight of 86.11 g/mol. Its IUPAC name is (2S)-2-aminobutanal.
Molecular Properties
| Compound Name | (2S)-2-aminobutanal |
| PubChem CID | 138857479 |
| Molecular Formula | C4H8NO- |
| Molecular Weight | 86.11 g/mol |
| Exact Mass | 86.06 |
| IUPAC Name | (2S)-2-aminobutanal |
| SMILES | [CH2-]C[C@H](N)C=O |
| InChI | InChI=1S/C4H8NO/c1-2-4(5)3-6/h3-4H,1-2,5H2/q-1/t4-/m0/s1 |
| InChIKey | FBORFTOIAJJMEK-BYPYZUCNSA-N |
| XLogP | -0.26 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.11 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-aminobutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminobutanal?
The IUPAC name of (2S)-2-aminobutanal (CID 138857479) is (2S)-2-aminobutanal.
What is the SMILES notation for (2S)-2-aminobutanal?
The canonical SMILES for (2S)-2-aminobutanal is [CH2-]C[C@H](N)C=O.
What is the InChIKey of (2S)-2-aminobutanal?
The InChIKey is FBORFTOIAJJMEK-BYPYZUCNSA-N. The full InChI is InChI=1S/C4H8NO/c1-2-4(5)3-6/h3-4H,1-2,5H2/q-1/t4-/m0/s1.
What are the key properties of (2S)-2-aminobutanal?
(2S)-2-aminobutanal has a molecular weight of 86.11 g/mol, XLogP of -0.26, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminobutanal is sourced from PubChem (CID 138857479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).