C15H20N6O2 — CID 138858171
3-butyl-5-tert-butyl-3,4,7,8,10,12-hexazatricyclo[7.4.0.02,7]trideca-1,4,8,10-tetraene-6,13-dione (PubChem CID 138858171) has the molecular formula C15H20N6O2 and a molecular weight of 316.37 g/mol. Its IUPAC name is 3-butyl-5-tert-butyl-3,4,7,8,10,12-hexazatricyclo[7.4.0.02,7]trideca-1,4,8,10-tetraene-6,13-dione.
| Compound Name | 3-butyl-5-tert-butyl-3,4,7,8,10,12-hexazatricyclo[7.4.0.02,7]trideca-1,4,8,10-tetraene-6,13-dione |
|---|---|
| PubChem CID | 138858171 |
| Molecular Formula | C15H20N6O2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 3-butyl-5-tert-butyl-3,4,7,8,10,12-hexazatricyclo[7.4.0.02,7]trideca-1,4,8,10-tetraene-6,13-dione |
| SMILES | CCCCn1nc(C(C)(C)C)c(=O)n2nc3nc[nH]c(=O)c3c12 |
| InChI | InChI=1S/C15H20N6O2/c1-5-6-7-20-13-9-11(16-8-17-12(9)22)19-21(13)14(23)10(18-20)15(2,3)4/h8H,5-7H2,1-4H3,(H,16,17,19,22) |
| InChIKey | QFIMZEYDBRWTRO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 97.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |