C19H12ClN5O4 — CID 138858320
[3-(4-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]-[1-(4-nitrophenyl)triazol-4-yl]methanone (PubChem CID 138858320) has the molecular formula C19H12ClN5O4 and a molecular weight of 409.79 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]-[1-(4-nitrophenyl)triazol-4-yl]methanone.
| Compound Name | [3-(4-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]-[1-(4-nitrophenyl)triazol-4-yl]methanone |
|---|---|
| PubChem CID | 138858320 |
| Molecular Formula | C19H12ClN5O4 |
| Molecular Weight | 409.79 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | [3-(4-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]-[1-(4-nitrophenyl)triazol-4-yl]methanone |
| SMILES | Cc1onc(-c2ccc(Cl)cc2)c1C(=O)c1cn(-c2ccc([N+](=O)[O-])cc2)nn1 |
| InChI | InChI=1S/C19H12ClN5O4/c1-11-17(18(22-29-11)12-2-4-13(20)5-3-12)19(26)16-10-24(23-21-16)14-6-8-15(9-7-14)25(27)28/h2-10H,1H3 |
| InChIKey | MNEUKSGDIOMIDI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 116.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.79 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|