C21H22F6O6 — CID 138858379
5-(dimethoxymethyl)-3-[2-[5-(dimethoxymethyl)-2-methylfuran-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-methylfuran (PubChem CID 138858379) has the molecular formula C21H22F6O6 and a molecular weight of 484.39 g/mol. Its IUPAC name is 5-(dimethoxymethyl)-3-[2-[5-(dimethoxymethyl)-2-methylfuran-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-methylfuran.
| Compound Name | 5-(dimethoxymethyl)-3-[2-[5-(dimethoxymethyl)-2-methylfuran-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-methylfuran |
|---|---|
| PubChem CID | 138858379 |
| Molecular Formula | C21H22F6O6 |
| Molecular Weight | 484.39 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 5-(dimethoxymethyl)-3-[2-[5-(dimethoxymethyl)-2-methylfuran-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-methylfuran |
| SMILES | COC(OC)c1cc(C2=C(c3cc(C(OC)OC)oc3C)C(F)(F)C(F)(F)C2(F)F)c(C)o1 |
| InChI | InChI=1S/C21H22F6O6/c1-9-11(7-13(32-9)17(28-3)29-4)15-16(20(24,25)21(26,27)19(15,22)23)12-8-14(33-10(12)2)18(30-5)31-6/h7-8,17-18H,1-6H3 |
| InChIKey | MCOQOEHNXCNWMY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 63.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.39 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|