C28H19N5OS — CID 1388652
10-(furan-2-ylmethyl)-11,12-diphenyl-4-thiophen-2-yl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 1388652) has the molecular formula C28H19N5OS and a molecular weight of 473.56 g/mol. Its IUPAC name is 10-(furan-2-ylmethyl)-11,12-diphenyl-4-thiophen-2-yl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 10-(furan-2-ylmethyl)-11,12-diphenyl-4-thiophen-2-yl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 1388652 |
| Molecular Formula | C28H19N5OS |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 10-(furan-2-ylmethyl)-11,12-diphenyl-4-thiophen-2-yl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | c1ccc(-c2c(-c3ccccc3)n(Cc3ccco3)c3ncn4nc(-c5cccs5)nc4c23)cc1 |
| InChI | InChI=1S/C28H19N5OS/c1-3-9-19(10-4-1)23-24-27(29-18-33-28(24)30-26(31-33)22-14-8-16-35-22)32(17-21-13-7-15-34-21)25(23)20-11-5-2-6-12-20/h1-16,18H,17H2 |
| InChIKey | UIDXUKZHYQZTQD-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 61.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |