About 2-phenylpyridine
2-phenylpyridine (PubChem CID 13887) has the molecular formula C11H9N
and a molecular weight of 155.20 g/mol. Its IUPAC name is 2-phenylpyridine.
Molecular Properties
| Compound Name | 2-phenylpyridine |
| PubChem CID | 13887 |
| Molecular Formula | C11H9N |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 2-phenylpyridine |
| SMILES | c1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C11H9N/c1-2-6-10(7-3-1)11-8-4-5-9-12-11/h1-9H |
| InChIKey | VQGHOUODWALEFC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylpyridine?
The IUPAC name of 2-phenylpyridine (CID 13887) is 2-phenylpyridine.
What is the SMILES notation for 2-phenylpyridine?
The canonical SMILES for 2-phenylpyridine is c1ccc(-c2ccccn2)cc1.
What is the InChIKey of 2-phenylpyridine?
The InChIKey is VQGHOUODWALEFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N/c1-2-6-10(7-3-1)11-8-4-5-9-12-11/h1-9H.
What are the key properties of 2-phenylpyridine?
2-phenylpyridine has a molecular weight of 155.20 g/mol, XLogP of 2.75, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpyridine is sourced from PubChem (CID 13887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).