C9H15N3 — CID 13889
2,4,6-triethyl-1,3,5-triazine (PubChem CID 13889) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 2,4,6-triethyl-1,3,5-triazine.
| Compound Name | 2,4,6-triethyl-1,3,5-triazine |
|---|---|
| PubChem CID | 13889 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 2,4,6-triethyl-1,3,5-triazine |
| SMILES | CCc1nc(CC)nc(CC)n1 |
| InChI | InChI=1S/C9H15N3/c1-4-7-10-8(5-2)12-9(6-3)11-7/h4-6H2,1-3H3 |
| InChIKey | GIIYEYPYVJAMBU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |