C16H13BrN4O2S — CID 1388900
1-[5-(3-bromophenyl)-1,3,4-thiadiazol-2-yl]-3-(3-methoxyphenyl)urea (PubChem CID 1388900) has the molecular formula C16H13BrN4O2S and a molecular weight of 405.28 g/mol. Its IUPAC name is 1-[5-(3-bromophenyl)-1,3,4-thiadiazol-2-yl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[5-(3-bromophenyl)-1,3,4-thiadiazol-2-yl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 1388900 |
| Molecular Formula | C16H13BrN4O2S |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | 1-[5-(3-bromophenyl)-1,3,4-thiadiazol-2-yl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)Nc2nnc(-c3cccc(Br)c3)s2)c1 |
| InChI | InChI=1S/C16H13BrN4O2S/c1-23-13-7-3-6-12(9-13)18-15(22)19-16-21-20-14(24-16)10-4-2-5-11(17)8-10/h2-9H,1H3,(H2,18,19,21,22) |
| InChIKey | UPVFSIOMQVSHKP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |