C19H29N — CID 1388970
N-[(1R)-1-phenylethyl]-1-prop-2-enylcyclooctan-1-amine (PubChem CID 1388970) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is N-[(1R)-1-phenylethyl]-1-prop-2-enylcyclooctan-1-amine.
| Compound Name | N-[(1R)-1-phenylethyl]-1-prop-2-enylcyclooctan-1-amine |
|---|---|
| PubChem CID | 1388970 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | N-[(1R)-1-phenylethyl]-1-prop-2-enylcyclooctan-1-amine |
| SMILES | C=CCC1(N[C@H](C)c2ccccc2)CCCCCCC1 |
| InChI | InChI=1S/C19H29N/c1-3-14-19(15-10-5-4-6-11-16-19)20-17(2)18-12-8-7-9-13-18/h3,7-9,12-13,17,20H,1,4-6,10-11,14-16H2,2H3/t17-/m1/s1 |
| InChIKey | GJZMBLUKJQBDML-QGZVFWFLSA-N |
| XLogP | 5.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|