C20H18FN3O3 — CID 1389049
1-(3,4-dimethylphenyl)-5-[(4-fluorophenyl)methyliminomethyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 1389049) has the molecular formula C20H18FN3O3 and a molecular weight of 367.38 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-5-[(4-fluorophenyl)methyliminomethyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-(3,4-dimethylphenyl)-5-[(4-fluorophenyl)methyliminomethyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 1389049 |
| Molecular Formula | C20H18FN3O3 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-5-[(4-fluorophenyl)methyliminomethyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | Cc1ccc(-n2c(O)c(/C=N/Cc3ccc(F)cc3)c(=O)[nH]c2=O)cc1C |
| InChI | InChI=1S/C20H18FN3O3/c1-12-3-8-16(9-13(12)2)24-19(26)17(18(25)23-20(24)27)11-22-10-14-4-6-15(21)7-5-14/h3-9,11,26H,10H2,1-2H3,(H,23,25,27)/b22-11+ |
| InChIKey | GBSFSYZJEZHWMK-SSDVNMTOSA-N |
| XLogP | 2.61 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|