C19H19N3O2S — CID 1389058
2-methoxy-N-[5-[(1S)-1-phenylpropyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 1389058) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is 2-methoxy-N-[5-[(1S)-1-phenylpropyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2-methoxy-N-[5-[(1S)-1-phenylpropyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 1389058 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 2-methoxy-N-[5-[(1S)-1-phenylpropyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CC[C@@H](c1ccccc1)c1nnc(NC(=O)c2ccccc2OC)s1 |
| InChI | InChI=1S/C19H19N3O2S/c1-3-14(13-9-5-4-6-10-13)18-21-22-19(25-18)20-17(23)15-11-7-8-12-16(15)24-2/h4-12,14H,3H2,1-2H3,(H,20,22,23)/t14-/m0/s1 |
| InChIKey | WKUOAULFFPWXNY-AWEZNQCLSA-N |
| XLogP | 4.34 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |