C10H16O2 — CID 138911144
(2E,6R,7E)-8-hydroxy-2,6-dimethylocta-2,7-dienal (PubChem CID 138911144) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (2E,6R,7E)-8-hydroxy-2,6-dimethylocta-2,7-dienal.
| Compound Name | (2E,6R,7E)-8-hydroxy-2,6-dimethylocta-2,7-dienal |
|---|---|
| PubChem CID | 138911144 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (2E,6R,7E)-8-hydroxy-2,6-dimethylocta-2,7-dienal |
| SMILES | C/C(C=O)=C\CC[C@@H](C)/C=C/O |
| InChI | InChI=1S/C10H16O2/c1-9(6-7-11)4-3-5-10(2)8-12/h5-9,11H,3-4H2,1-2H3/b7-6+,10-5+/t9-/m1/s1 |
| InChIKey | CUVKIWGKVWHEEO-YYSBFJSKSA-N |
| XLogP | 2.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|