C22H25NO2 — CID 138911230
(7R)-N-(4-methoxyphenyl)-7-phenylnon-5-ynamide (PubChem CID 138911230) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is (7R)-N-(4-methoxyphenyl)-7-phenylnon-5-ynamide.
| Compound Name | (7R)-N-(4-methoxyphenyl)-7-phenylnon-5-ynamide |
|---|---|
| PubChem CID | 138911230 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | (7R)-N-(4-methoxyphenyl)-7-phenylnon-5-ynamide |
| SMILES | CC[C@@H](C#CCCCC(=O)Nc1ccc(OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H25NO2/c1-3-18(19-11-7-4-8-12-19)10-6-5-9-13-22(24)23-20-14-16-21(25-2)17-15-20/h4,7-8,11-12,14-18H,3,5,9,13H2,1-2H3,(H,23,24)/t18-/m0/s1 |
| InChIKey | YYPYTPPUWFFFBW-SFHVURJKSA-N |
| XLogP | 5.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|