C43H34F12N3O2P — CID 138911248
2-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]benzamide (PubChem CID 138911248) has the molecular formula C43H34F12N3O2P and a molecular weight of 883.71 g/mol. Its IUPAC name is 2-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]benzamide.
| Compound Name | 2-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 138911248 |
| Molecular Formula | C43H34F12N3O2P |
| Molecular Weight | 883.71 g/mol |
| Exact Mass | 883.22 |
| IUPAC Name | 2-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]benzamide |
| SMILES | C=CC1CN2CCC1CC2[C@@H](NC(=O)c1ccccc1P(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C43H34F12N3O2P/c1-3-23-22-58-13-11-24(23)14-36(58)38(32-10-12-56-35-9-8-29(60-2)21-34(32)35)57-39(59)33-6-4-5-7-37(33)61(30-17-25(40(44,45)46)15-26(18-30)41(47,48)49)31-19-27(42(50,51)52)16-28(20-31)43(53,54)55/h3-10,12,15-21,23-24,36,38H,1,11,13-14,22H2,2H3,(H,57,59)/t23?,24?,36?,38-/m0/s1 |
| InChIKey | JAJIQBCLVBTWPA-FUNSTBRTSA-N |
| XLogP | 10.44 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.71 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|