About 7-benzyl-8-[(4-methoxyphenyl)methylamino]-3-methylpurine-2,6-dione
7-benzyl-8-[(4-methoxyphenyl)methylamino]-3-methylpurine-2,6-dione (PubChem CID 1389133) has the molecular formula C21H21N5O3
and a molecular weight of 391.43 g/mol. Its IUPAC name is 7-benzyl-8-[(4-methoxyphenyl)methylamino]-3-methylpurine-2,6-dione.
Molecular Properties
| Compound Name | 7-benzyl-8-[(4-methoxyphenyl)methylamino]-3-methylpurine-2,6-dione |
| PubChem CID | 1389133 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 7-benzyl-8-[(4-methoxyphenyl)methylamino]-3-methylpurine-2,6-dione |
| SMILES | COc1ccc(CNc2nc3c(c(=O)[nH]c(=O)n3C)n2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H21N5O3/c1-25-18-17(19(27)24-21(25)28)26(13-15-6-4-3-5-7-15)20(23-18)22-12-14-8-10-16(29-2)11-9-14/h3-11H,12-13H2,1-2H3,(H,22,23)(H,24,27,28) |
| InChIKey | JPSKWZSMXSULIJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-benzyl-8-[(4-methoxyphenyl)methylamino]-3-methylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-benzyl-8-[(4-methoxyphenyl)methylamino]-3-methylpurine-2,6-dione?
The IUPAC name of 7-benzyl-8-[(4-methoxyphenyl)methylamino]-3-methylpurine-2,6-dione (CID 1389133) is 7-benzyl-8-[(4-methoxyphenyl)methylamino]-3-methylpurine-2,6-dione.
What is the SMILES notation for 7-benzyl-8-[(4-methoxyphenyl)methylamino]-3-methylpurine-2,6-dione?
The canonical SMILES for 7-benzyl-8-[(4-methoxyphenyl)methylamino]-3-methylpurine-2,6-dione is COc1ccc(CNc2nc3c(c(=O)[nH]c(=O)n3C)n2Cc2ccccc2)cc1.
What is the InChIKey of 7-benzyl-8-[(4-methoxyphenyl)methylamino]-3-methylpurine-2,6-dione?
The InChIKey is JPSKWZSMXSULIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N5O3/c1-25-18-17(19(27)24-21(25)28)26(13-15-6-4-3-5-7-15)20(23-18)22-12-14-8-10-16(29-2)11-9-14/h3-11H,12-13H2,1-2H3,(H,22,23)(H,24,27,28).
What are the key properties of 7-benzyl-8-[(4-methoxyphenyl)methylamino]-3-methylpurine-2,6-dione?
7-benzyl-8-[(4-methoxyphenyl)methylamino]-3-methylpurine-2,6-dione has a molecular weight of 391.43 g/mol, XLogP of 2.09, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-benzyl-8-[(4-methoxyphenyl)methylamino]-3-methylpurine-2,6-dione is sourced from PubChem (CID 1389133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).