C21H20ClN2O2+ — CID 1389162
2-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-1-(3-methoxyphenyl)ethanone (PubChem CID 1389162) has the molecular formula C21H20ClN2O2+ and a molecular weight of 367.86 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-1-(3-methoxyphenyl)ethanone.
| Compound Name | 2-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-1-(3-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 1389162 |
| Molecular Formula | C21H20ClN2O2+ |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-1-(3-methoxyphenyl)ethanone |
| SMILES | COc1cccc(C(=O)C[n+]2cc(-c3ccc(Cl)cc3)n3c2CCC3)c1 |
| InChI | InChI=1S/C21H20ClN2O2/c1-26-18-5-2-4-16(12-18)20(25)14-23-13-19(24-11-3-6-21(23)24)15-7-9-17(22)10-8-15/h2,4-5,7-10,12-13H,3,6,11,14H2,1H3/q+1 |
| InChIKey | KHQPNAJWOPEPJI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|