C25H24N4O2 — CID 1389349
N,N-diethyl-4-[4-(3-hydroxyanilino)phthalazin-1-yl]benzamide (PubChem CID 1389349) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is N,N-diethyl-4-[4-(3-hydroxyanilino)phthalazin-1-yl]benzamide.
| Compound Name | N,N-diethyl-4-[4-(3-hydroxyanilino)phthalazin-1-yl]benzamide |
|---|---|
| PubChem CID | 1389349 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N,N-diethyl-4-[4-(3-hydroxyanilino)phthalazin-1-yl]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(-c2nnc(Nc3cccc(O)c3)c3ccccc23)cc1 |
| InChI | InChI=1S/C25H24N4O2/c1-3-29(4-2)25(31)18-14-12-17(13-15-18)23-21-10-5-6-11-22(21)24(28-27-23)26-19-8-7-9-20(30)16-19/h5-16,30H,3-4H2,1-2H3,(H,26,28) |
| InChIKey | CDPSTQGSZGTMHF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |