C18H20O4 — CID 138958202
2-[[(1R,2R,6R,7R,8S)-8-tricyclo[5.2.1.02,6]decanyl]oxycarbonyl]benzoic acid (PubChem CID 138958202) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-[[(1R,2R,6R,7R,8S)-8-tricyclo[5.2.1.02,6]decanyl]oxycarbonyl]benzoic acid.
| Compound Name | 2-[[(1R,2R,6R,7R,8S)-8-tricyclo[5.2.1.02,6]decanyl]oxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 138958202 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-[[(1R,2R,6R,7R,8S)-8-tricyclo[5.2.1.02,6]decanyl]oxycarbonyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)O[C@H]1C[C@H]2C[C@@H]1[C@@H]1CCC[C@H]21 |
| InChI | InChI=1S/C18H20O4/c19-17(20)13-4-1-2-5-14(13)18(21)22-16-9-10-8-15(16)12-7-3-6-11(10)12/h1-2,4-5,10-12,15-16H,3,6-9H2,(H,19,20)/t10-,11-,12-,15-,16+/m1/s1 |
| InChIKey | DILXHIQZGJKWQB-BQJFBPGXSA-N |
| XLogP | 3.37 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |