About 6-bromo-2-(2,2,2-trifluoroethyl)phthalazin-1-one
6-bromo-2-(2,2,2-trifluoroethyl)phthalazin-1-one (PubChem CID 138958359) has the molecular formula C10H6BrF3N2O
and a molecular weight of 307.07 g/mol. Its IUPAC name is 6-bromo-2-(2,2,2-trifluoroethyl)phthalazin-1-one.
Molecular Properties
| Compound Name | 6-bromo-2-(2,2,2-trifluoroethyl)phthalazin-1-one |
| PubChem CID | 138958359 |
| Molecular Formula | C10H6BrF3N2O |
| Molecular Weight | 307.07 g/mol |
| Exact Mass | 305.96 |
| IUPAC Name | 6-bromo-2-(2,2,2-trifluoroethyl)phthalazin-1-one |
| SMILES | O=c1c2ccc(Br)cc2cnn1CC(F)(F)F |
| InChI | InChI=1S/C10H6BrF3N2O/c11-7-1-2-8-6(3-7)4-15-16(9(8)17)5-10(12,13)14/h1-4H,5H2 |
| InChIKey | OVPMJPOKIVKERP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.07 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-2-(2,2,2-trifluoroethyl)phthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-(2,2,2-trifluoroethyl)phthalazin-1-one?
The IUPAC name of 6-bromo-2-(2,2,2-trifluoroethyl)phthalazin-1-one (CID 138958359) is 6-bromo-2-(2,2,2-trifluoroethyl)phthalazin-1-one.
What is the SMILES notation for 6-bromo-2-(2,2,2-trifluoroethyl)phthalazin-1-one?
The canonical SMILES for 6-bromo-2-(2,2,2-trifluoroethyl)phthalazin-1-one is O=c1c2ccc(Br)cc2cnn1CC(F)(F)F.
What is the InChIKey of 6-bromo-2-(2,2,2-trifluoroethyl)phthalazin-1-one?
The InChIKey is OVPMJPOKIVKERP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6BrF3N2O/c11-7-1-2-8-6(3-7)4-15-16(9(8)17)5-10(12,13)14/h1-4H,5H2.
What are the key properties of 6-bromo-2-(2,2,2-trifluoroethyl)phthalazin-1-one?
6-bromo-2-(2,2,2-trifluoroethyl)phthalazin-1-one has a molecular weight of 307.07 g/mol, XLogP of 2.72, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-(2,2,2-trifluoroethyl)phthalazin-1-one is sourced from PubChem (CID 138958359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).