C20H24ClNO2 — CID 138959543
1-(2,3-dihydroindol-1-yl)-3-(2-prop-2-enylphenoxy)propan-2-ol;hydrochloride (PubChem CID 138959543) has the molecular formula C20H24ClNO2 and a molecular weight of 345.87 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-yl)-3-(2-prop-2-enylphenoxy)propan-2-ol;hydrochloride.
| Compound Name | 1-(2,3-dihydroindol-1-yl)-3-(2-prop-2-enylphenoxy)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 138959543 |
| Molecular Formula | C20H24ClNO2 |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)-3-(2-prop-2-enylphenoxy)propan-2-ol;hydrochloride |
| SMILES | C=CCc1ccccc1OCC(O)CN1CCc2ccccc21.Cl |
| InChI | InChI=1S/C20H23NO2.ClH/c1-2-7-17-9-4-6-11-20(17)23-15-18(22)14-21-13-12-16-8-3-5-10-19(16)21;/h2-6,8-11,18,22H,1,7,12-15H2;1H |
| InChIKey | SMQBSLSMYQZBPK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|