C21H16N2O2S2 — CID 1389599
13-(4-methoxyphenyl)-14-sulfanylidene-17-thia-13,15-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16)-pentaen-12-one (PubChem CID 1389599) has the molecular formula C21H16N2O2S2 and a molecular weight of 392.51 g/mol. Its IUPAC name is 13-(4-methoxyphenyl)-14-sulfanylidene-17-thia-13,15-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16)-pentaen-12-one.
| Compound Name | 13-(4-methoxyphenyl)-14-sulfanylidene-17-thia-13,15-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16)-pentaen-12-one |
|---|---|
| PubChem CID | 1389599 |
| Molecular Formula | C21H16N2O2S2 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 13-(4-methoxyphenyl)-14-sulfanylidene-17-thia-13,15-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16)-pentaen-12-one |
| SMILES | COc1ccc(-n2c(=S)[nH]c3sc4c(c3c2=O)CCc2ccccc2-4)cc1 |
| InChI | InChI=1S/C21H16N2O2S2/c1-25-14-9-7-13(8-10-14)23-20(24)17-16-11-6-12-4-2-3-5-15(12)18(16)27-19(17)22-21(23)26/h2-5,7-10H,6,11H2,1H3,(H,22,26) |
| InChIKey | VDYNTXXHZMEDPD-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|