C7HCl5O2 — CID 13896
2,3,4,5,6-pentachlorobenzoic acid (PubChem CID 13896) has the molecular formula C7HCl5O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2,3,4,5,6-pentachlorobenzoic acid.
| Compound Name | 2,3,4,5,6-pentachlorobenzoic acid |
|---|---|
| PubChem CID | 13896 |
| Molecular Formula | C7HCl5O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 291.84 |
| IUPAC Name | 2,3,4,5,6-pentachlorobenzoic acid |
| SMILES | O=C(O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C7HCl5O2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h(H,13,14) |
| InChIKey | IONYGGJUUJFXJK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|