C24H29ClN2O3 — CID 138960595
1-[2-(oxan-4-yl)benzimidazol-1-yl]-3-(2-prop-2-enylphenoxy)propan-2-ol;hydrochloride (PubChem CID 138960595) has the molecular formula C24H29ClN2O3 and a molecular weight of 428.96 g/mol. Its IUPAC name is 1-[2-(oxan-4-yl)benzimidazol-1-yl]-3-(2-prop-2-enylphenoxy)propan-2-ol;hydrochloride.
| Compound Name | 1-[2-(oxan-4-yl)benzimidazol-1-yl]-3-(2-prop-2-enylphenoxy)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 138960595 |
| Molecular Formula | C24H29ClN2O3 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 1-[2-(oxan-4-yl)benzimidazol-1-yl]-3-(2-prop-2-enylphenoxy)propan-2-ol;hydrochloride |
| SMILES | C=CCc1ccccc1OCC(O)Cn1c(C2CCOCC2)nc2ccccc21.Cl |
| InChI | InChI=1S/C24H28N2O3.ClH/c1-2-7-18-8-3-6-11-23(18)29-17-20(27)16-26-22-10-5-4-9-21(22)25-24(26)19-12-14-28-15-13-19;/h2-6,8-11,19-20,27H,1,7,12-17H2;1H |
| InChIKey | CXJKLTOIOJLVLL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|