About 5-(4-chlorophenyl)-2,3,7,8-tetrafluorothianthren-5-ium
5-(4-chlorophenyl)-2,3,7,8-tetrafluorothianthren-5-ium (PubChem CID 138961656) has the molecular formula C18H8ClF4S2+
and a molecular weight of 399.84 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2,3,7,8-tetrafluorothianthren-5-ium.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-2,3,7,8-tetrafluorothianthren-5-ium |
| PubChem CID | 138961656 |
| Molecular Formula | C18H8ClF4S2+ |
| Molecular Weight | 399.84 g/mol |
| Exact Mass | 398.97 |
| IUPAC Name | 5-(4-chlorophenyl)-2,3,7,8-tetrafluorothianthren-5-ium |
| SMILES | Fc1cc2c(cc1F)[S+](c1ccc(Cl)cc1)c1cc(F)c(F)cc1S2 |
| InChI | InChI=1S/C18H8ClF4S2/c19-9-1-3-10(4-2-9)25-17-7-13(22)11(20)5-15(17)24-16-6-12(21)14(23)8-18(16)25/h1-8H/q+1 |
| InChIKey | WORMLVZNWCXRLB-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.84 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-chlorophenyl)-2,3,7,8-tetrafluorothianthren-5-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-2,3,7,8-tetrafluorothianthren-5-ium?
The IUPAC name of 5-(4-chlorophenyl)-2,3,7,8-tetrafluorothianthren-5-ium (CID 138961656) is 5-(4-chlorophenyl)-2,3,7,8-tetrafluorothianthren-5-ium.
What is the SMILES notation for 5-(4-chlorophenyl)-2,3,7,8-tetrafluorothianthren-5-ium?
The canonical SMILES for 5-(4-chlorophenyl)-2,3,7,8-tetrafluorothianthren-5-ium is Fc1cc2c(cc1F)[S+](c1ccc(Cl)cc1)c1cc(F)c(F)cc1S2.
What is the InChIKey of 5-(4-chlorophenyl)-2,3,7,8-tetrafluorothianthren-5-ium?
The InChIKey is WORMLVZNWCXRLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H8ClF4S2/c19-9-1-3-10(4-2-9)25-17-7-13(22)11(20)5-15(17)24-16-6-12(21)14(23)8-18(16)25/h1-8H/q+1.
What are the key properties of 5-(4-chlorophenyl)-2,3,7,8-tetrafluorothianthren-5-ium?
5-(4-chlorophenyl)-2,3,7,8-tetrafluorothianthren-5-ium has a molecular weight of 399.84 g/mol, XLogP of 6.46, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-2,3,7,8-tetrafluorothianthren-5-ium is sourced from PubChem (CID 138961656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).