C25H11BF8O2S2 — CID 138961673
2-(2,3,7,8-tetrafluorothianthren-5-ium-5-yl)xanthen-9-one tetrafluoroborate (PubChem CID 138961673) has the molecular formula C25H11BF8O2S2 and a molecular weight of 570.29 g/mol. Its IUPAC name is 2-(2,3,7,8-tetrafluorothianthren-5-ium-5-yl)xanthen-9-one tetrafluoroborate.
| Compound Name | 2-(2,3,7,8-tetrafluorothianthren-5-ium-5-yl)xanthen-9-one tetrafluoroborate |
|---|---|
| PubChem CID | 138961673 |
| Molecular Formula | C25H11BF8O2S2 |
| Molecular Weight | 570.29 g/mol |
| Exact Mass | 570.02 |
| IUPAC Name | 2-(2,3,7,8-tetrafluorothianthren-5-ium-5-yl)xanthen-9-one tetrafluoroborate |
| SMILES | F[B-](F)(F)F.O=c1c2ccccc2oc2ccc([S+]3c4cc(F)c(F)cc4Sc4cc(F)c(F)cc43)cc12 |
| InChI | InChI=1S/C25H11F4O2S2.BF4/c26-15-8-21-23(10-17(15)28)33(24-11-18(29)16(27)9-22(24)32-21)12-5-6-20-14(7-12)25(30)13-3-1-2-4-19(13)31-20;2-1(3,4)5/h1-11H;/q+1;-1 |
| InChIKey | BRTIBXDZJYTYQG-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.29 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|