About methyl 2-[3-fluoro-4-(4-thianthren-5-ium-5-ylphenyl)phenyl]propanoate tetrafluoroborate
methyl 2-[3-fluoro-4-(4-thianthren-5-ium-5-ylphenyl)phenyl]propanoate tetrafluoroborate (PubChem CID 138961696) has the molecular formula C28H22BF5O2S2
and a molecular weight of 560.42 g/mol. Its IUPAC name is methyl 2-[3-fluoro-4-(4-thianthren-5-ium-5-ylphenyl)phenyl]propanoate tetrafluoroborate.
Molecular Properties
| Compound Name | methyl 2-[3-fluoro-4-(4-thianthren-5-ium-5-ylphenyl)phenyl]propanoate tetrafluoroborate |
| PubChem CID | 138961696 |
| Molecular Formula | C28H22BF5O2S2 |
| Molecular Weight | 560.42 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | methyl 2-[3-fluoro-4-(4-thianthren-5-ium-5-ylphenyl)phenyl]propanoate tetrafluoroborate |
| SMILES | COC(=O)C(C)c1ccc(-c2ccc([S+]3c4ccccc4Sc4ccccc43)cc2)c(F)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C28H22FO2S2.BF4/c1-18(28(30)31-2)20-13-16-22(23(29)17-20)19-11-14-21(15-12-19)33-26-9-5-3-7-24(26)32-25-8-4-6-10-27(25)33;2-1(3,4)5/h3-18H,1-2H3;/q+1;-1 |
| InChIKey | CPOTWRQEQUXRCU-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 560.42 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[3-fluoro-4-(4-thianthren-5-ium-5-ylphenyl)phenyl]propanoate tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3-fluoro-4-(4-thianthren-5-ium-5-ylphenyl)phenyl]propanoate tetrafluoroborate?
The IUPAC name of methyl 2-[3-fluoro-4-(4-thianthren-5-ium-5-ylphenyl)phenyl]propanoate tetrafluoroborate (CID 138961696) is methyl 2-[3-fluoro-4-(4-thianthren-5-ium-5-ylphenyl)phenyl]propanoate tetrafluoroborate.
What is the SMILES notation for methyl 2-[3-fluoro-4-(4-thianthren-5-ium-5-ylphenyl)phenyl]propanoate tetrafluoroborate?
The canonical SMILES for methyl 2-[3-fluoro-4-(4-thianthren-5-ium-5-ylphenyl)phenyl]propanoate tetrafluoroborate is COC(=O)C(C)c1ccc(-c2ccc([S+]3c4ccccc4Sc4ccccc43)cc2)c(F)c1.F[B-](F)(F)F.
What is the InChIKey of methyl 2-[3-fluoro-4-(4-thianthren-5-ium-5-ylphenyl)phenyl]propanoate tetrafluoroborate?
The InChIKey is CPOTWRQEQUXRCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H22FO2S2.BF4/c1-18(28(30)31-2)20-13-16-22(23(29)17-20)19-11-14-21(15-12-19)33-26-9-5-3-7-24(26)32-25-8-4-6-10-27(25)33;2-1(3,4)5/h3-18H,1-2H3;/q+1;-1.
What are the key properties of methyl 2-[3-fluoro-4-(4-thianthren-5-ium-5-ylphenyl)phenyl]propanoate tetrafluoroborate?
methyl 2-[3-fluoro-4-(4-thianthren-5-ium-5-ylphenyl)phenyl]propanoate tetrafluoroborate has a molecular weight of 560.42 g/mol, XLogP of 8.63, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-fluoro-4-(4-thianthren-5-ium-5-ylphenyl)phenyl]propanoate tetrafluoroborate is sourced from PubChem (CID 138961696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).