About 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylmethanamine;palladium(2+)
1-cyclopenta-1,3-dien-1-yl-N,N-dimethylmethanamine;palladium(2+) (PubChem CID 138962357) has the molecular formula C8H11NPd
and a molecular weight of 227.60 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylmethanamine;palladium(2+).
Molecular Properties
| Compound Name | 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylmethanamine;palladium(2+) |
| PubChem CID | 138962357 |
| Molecular Formula | C8H11NPd |
| Molecular Weight | 227.60 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylmethanamine;palladium(2+) |
| SMILES | CN(C)Cc1[c-]cc[cH-]1.[Pd+2] |
| InChI | InChI=1S/C8H11N.Pd/c1-9(2)7-8-5-3-4-6-8;/h3-5H,7H2,1-2H3;/q-2;+2 |
| InChIKey | SBBMXXLKDNFASA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.60 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylmethanamine;palladium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylmethanamine;palladium(2+)?
The IUPAC name of 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylmethanamine;palladium(2+) (CID 138962357) is 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylmethanamine;palladium(2+).
What is the SMILES notation for 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylmethanamine;palladium(2+)?
The canonical SMILES for 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylmethanamine;palladium(2+) is CN(C)Cc1[c-]cc[cH-]1.[Pd+2].
What is the InChIKey of 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylmethanamine;palladium(2+)?
The InChIKey is SBBMXXLKDNFASA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.Pd/c1-9(2)7-8-5-3-4-6-8;/h3-5H,7H2,1-2H3;/q-2;+2.
What are the key properties of 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylmethanamine;palladium(2+)?
1-cyclopenta-1,3-dien-1-yl-N,N-dimethylmethanamine;palladium(2+) has a molecular weight of 227.60 g/mol, XLogP of 1.26, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-1,3-dien-1-yl-N,N-dimethylmethanamine;palladium(2+) is sourced from PubChem (CID 138962357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).