C55H70Li2 — CID 138962493
dilithium;2,4-bis[bis(4-tert-butylphenyl)methyl]-3-methyl-1,5-di(propan-2-yl)benzene (PubChem CID 138962493) has the molecular formula C55H70Li2 and a molecular weight of 745.05 g/mol. Its IUPAC name is dilithium;2,4-bis[bis(4-tert-butylphenyl)methyl]-3-methyl-1,5-di(propan-2-yl)benzene.
| Compound Name | dilithium;2,4-bis[bis(4-tert-butylphenyl)methyl]-3-methyl-1,5-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 138962493 |
| Molecular Formula | C55H70Li2 |
| Molecular Weight | 745.05 g/mol |
| Exact Mass | 744.58 |
| IUPAC Name | dilithium;2,4-bis[bis(4-tert-butylphenyl)methyl]-3-methyl-1,5-di(propan-2-yl)benzene |
| SMILES | Cc1c([C-](c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)c(C(C)C)cc(C(C)C)c1[C-](c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1.[Li+].[Li+] |
| InChI | InChI=1S/C55H70.2Li/c1-35(2)46-34-47(36(3)4)49(51(40-22-30-44(31-23-40)54(12,13)14)41-24-32-45(33-25-41)55(15,16)17)37(5)48(46)50(38-18-26-42(27-19-38)52(6,7)8)39-20-28-43(29-21-39)53(9,10)11;;/h18-36H,1-17H3;;/q-2;2*+1 |
| InChIKey | XQRKURXYYROWSS-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.05 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|