About (1R,2R)-2-chloro-1,2-dideuterioethanol
(1R,2R)-2-chloro-1,2-dideuterioethanol (PubChem CID 138962773) has the molecular formula C2H5ClO
and a molecular weight of 82.53 g/mol. Its IUPAC name is (1R,2R)-2-chloro-1,2-dideuterioethanol.
Molecular Properties
| Compound Name | (1R,2R)-2-chloro-1,2-dideuterioethanol |
| PubChem CID | 138962773 |
| Molecular Formula | C2H5ClO |
| Molecular Weight | 82.53 g/mol |
| Exact Mass | 82.02 |
| IUPAC Name | (1R,2R)-2-chloro-1,2-dideuterioethanol |
| SMILES | [2H][C@@H](O)[C@@H]([2H])Cl |
| InChI | InChI=1S/C2H5ClO/c3-1-2-4/h4H,1-2H2/i1D,2D/t1-,2-/m1/s1 |
| InChIKey | SZIFAVKTNFCBPC-USYLWXOYSA-N |
| XLogP | 0.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 82.53 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (1R,2R)-2-chloro-1,2-dideuterioethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2R)-2-chloro-1,2-dideuterioethanol?
The IUPAC name of (1R,2R)-2-chloro-1,2-dideuterioethanol (CID 138962773) is (1R,2R)-2-chloro-1,2-dideuterioethanol.
What is the SMILES notation for (1R,2R)-2-chloro-1,2-dideuterioethanol?
The canonical SMILES for (1R,2R)-2-chloro-1,2-dideuterioethanol is [2H][C@@H](O)[C@@H]([2H])Cl.
What is the InChIKey of (1R,2R)-2-chloro-1,2-dideuterioethanol?
The InChIKey is SZIFAVKTNFCBPC-USYLWXOYSA-N. The full InChI is InChI=1S/C2H5ClO/c3-1-2-4/h4H,1-2H2/i1D,2D/t1-,2-/m1/s1.
What are the key properties of (1R,2R)-2-chloro-1,2-dideuterioethanol?
(1R,2R)-2-chloro-1,2-dideuterioethanol has a molecular weight of 82.53 g/mol, XLogP of 0.22, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2R)-2-chloro-1,2-dideuterioethanol is sourced from PubChem (CID 138962773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).