C40H46N8 — CID 138962825
(20Z)-5,15-dihexyl-10-(1-methylimidazol-2-yl)-20-(3-methyl-1H-imidazol-2-ylidene)-21H-porphyrin (PubChem CID 138962825) has the molecular formula C40H46N8 and a molecular weight of 638.86 g/mol. Its IUPAC name is (20Z)-5,15-dihexyl-10-(1-methylimidazol-2-yl)-20-(3-methyl-1H-imidazol-2-ylidene)-21H-porphyrin.
| Compound Name | (20Z)-5,15-dihexyl-10-(1-methylimidazol-2-yl)-20-(3-methyl-1H-imidazol-2-ylidene)-21H-porphyrin |
|---|---|
| PubChem CID | 138962825 |
| Molecular Formula | C40H46N8 |
| Molecular Weight | 638.86 g/mol |
| Exact Mass | 638.38 |
| IUPAC Name | (20Z)-5,15-dihexyl-10-(1-methylimidazol-2-yl)-20-(3-methyl-1H-imidazol-2-ylidene)-21H-porphyrin |
| SMILES | CCCCCC/C1=C2\C=CC(=N2)/C(=C2/NC=CN2C)c2ccc([nH]2)/C(CCCCCC)=C2/C=CC(=N2)/C(c2nccn2C)=C2/C=CC1=N2 |
| InChI | InChI=1S/C40H46N8/c1-5-7-9-11-13-27-29-15-19-33(43-29)37(39-41-23-25-47(39)3)35-21-17-31(45-35)28(14-12-10-8-6-2)32-18-22-36(46-32)38(34-20-16-30(27)44-34)40-42-24-26-48(40)4/h15-26,41,43H,5-14H2,1-4H3/b30-27-,31-28-,38-36+,39-37- |
| InChIKey | KZJNIBVFFQDQLU-MJFYTHDKSA-N |
| XLogP | 8.79 |
| TPSA | 85.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.86 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|