About tert-butyl N-butanimidoylcarbamate
tert-butyl N-butanimidoylcarbamate (PubChem CID 138962828) has the molecular formula C9H18N2O2
and a molecular weight of 186.25 g/mol. Its IUPAC name is tert-butyl N-butanimidoylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-butanimidoylcarbamate |
| PubChem CID | 138962828 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | tert-butyl N-butanimidoylcarbamate |
| SMILES | [H]/N=C(\CCC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H18N2O2/c1-5-6-7(10)11-8(12)13-9(2,3)4/h5-6H2,1-4H3,(H2,10,11,12) |
| InChIKey | RRXREZAPSNUTLX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-butanimidoylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-butanimidoylcarbamate?
The IUPAC name of tert-butyl N-butanimidoylcarbamate (CID 138962828) is tert-butyl N-butanimidoylcarbamate.
What is the SMILES notation for tert-butyl N-butanimidoylcarbamate?
The canonical SMILES for tert-butyl N-butanimidoylcarbamate is [H]/N=C(\CCC)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-butanimidoylcarbamate?
The InChIKey is RRXREZAPSNUTLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2/c1-5-6-7(10)11-8(12)13-9(2,3)4/h5-6H2,1-4H3,(H2,10,11,12).
What are the key properties of tert-butyl N-butanimidoylcarbamate?
tert-butyl N-butanimidoylcarbamate has a molecular weight of 186.25 g/mol, XLogP of 2.29, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-butanimidoylcarbamate is sourced from PubChem (CID 138962828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).