C29H34N4 — CID 138962853
(9Z,15Z,19Z)-2,3,4,7,8,12,13,17,18-nonamethyl-23,24-dihydro-5H-porphyrin (PubChem CID 138962853) has the molecular formula C29H34N4 and a molecular weight of 438.62 g/mol. Its IUPAC name is (9Z,15Z,19Z)-2,3,4,7,8,12,13,17,18-nonamethyl-23,24-dihydro-5H-porphyrin.
| Compound Name | (9Z,15Z,19Z)-2,3,4,7,8,12,13,17,18-nonamethyl-23,24-dihydro-5H-porphyrin |
|---|---|
| PubChem CID | 138962853 |
| Molecular Formula | C29H34N4 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | (9Z,15Z,19Z)-2,3,4,7,8,12,13,17,18-nonamethyl-23,24-dihydro-5H-porphyrin |
| SMILES | CC1=C(C)/C2=C/c3[nH]c(c(C)c3C)/C=c3\[nH]/c(c(C)c3C)=C\C3=NC(C)(CC1=N2)C(C)=C3C |
| InChI | InChI=1S/C29H34N4/c1-14-15(2)24-11-25-18(5)19(6)28(32-25)13-29(9)21(8)20(7)27(33-29)12-26-17(4)16(3)23(31-26)10-22(14)30-24/h10-12,30-31H,13H2,1-9H3/b23-10-,25-11-,26-12- |
| InChIKey | HLDRQGIOULMICR-NANMCHJRSA-N |
| XLogP | 5.27 |
| TPSA | 56.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |