About CID 138962948
CID 138962948 (PubChem CID 138962948) has the molecular formula C28H24NO3P+
and a molecular weight of 453.48 g/mol.
Molecular Properties
| Compound Name | CID 138962948 |
| PubChem CID | 138962948 |
| Molecular Formula | C28H24NO3P+ |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | — |
| SMILES | CC[P+]1(OC)C(c2ccccc2)=C[C](N2C(=O)c3ccccc3C2=O)C=C1c1ccccc1 |
| InChI | InChI=1S/C28H24NO3P/c1-3-33(32-2)25(20-12-6-4-7-13-20)18-22(19-26(33)21-14-8-5-9-15-21)29-27(30)23-16-10-11-17-24(23)28(29)31/h4-19H,3H2,1-2H3/q+1 |
| InChIKey | CWVKSYDAKFOMED-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze CID 138962948 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 138962948?
The IUPAC name of CID 138962948 (CID 138962948) is not available.
What is the SMILES notation for CID 138962948?
The canonical SMILES for CID 138962948 is CC[P+]1(OC)C(c2ccccc2)=C[C](N2C(=O)c3ccccc3C2=O)C=C1c1ccccc1.
What is the InChIKey of CID 138962948?
The InChIKey is CWVKSYDAKFOMED-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24NO3P/c1-3-33(32-2)25(20-12-6-4-7-13-20)18-22(19-26(33)21-14-8-5-9-15-21)29-27(30)23-16-10-11-17-24(23)28(29)31/h4-19H,3H2,1-2H3/q+1.
What are the key properties of CID 138962948?
CID 138962948 has a molecular weight of 453.48 g/mol, XLogP of 6.51, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 138962948 is sourced from PubChem (CID 138962948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).