About 7-amino-5,6-dimethoxychromen-2-one
7-amino-5,6-dimethoxychromen-2-one (PubChem CID 138963105) has the molecular formula C11H11NO4
and a molecular weight of 221.21 g/mol. Its IUPAC name is 7-amino-5,6-dimethoxychromen-2-one.
Molecular Properties
| Compound Name | 7-amino-5,6-dimethoxychromen-2-one |
| PubChem CID | 138963105 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 7-amino-5,6-dimethoxychromen-2-one |
| SMILES | COc1c(N)cc2oc(=O)ccc2c1OC |
| InChI | InChI=1S/C11H11NO4/c1-14-10-6-3-4-9(13)16-8(6)5-7(12)11(10)15-2/h3-5H,12H2,1-2H3 |
| InChIKey | CENYAFDXDQUPSX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-5,6-dimethoxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-5,6-dimethoxychromen-2-one?
The IUPAC name of 7-amino-5,6-dimethoxychromen-2-one (CID 138963105) is 7-amino-5,6-dimethoxychromen-2-one.
What is the SMILES notation for 7-amino-5,6-dimethoxychromen-2-one?
The canonical SMILES for 7-amino-5,6-dimethoxychromen-2-one is COc1c(N)cc2oc(=O)ccc2c1OC.
What is the InChIKey of 7-amino-5,6-dimethoxychromen-2-one?
The InChIKey is CENYAFDXDQUPSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO4/c1-14-10-6-3-4-9(13)16-8(6)5-7(12)11(10)15-2/h3-5H,12H2,1-2H3.
What are the key properties of 7-amino-5,6-dimethoxychromen-2-one?
7-amino-5,6-dimethoxychromen-2-one has a molecular weight of 221.21 g/mol, XLogP of 1.39, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-5,6-dimethoxychromen-2-one is sourced from PubChem (CID 138963105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).