C17H20F3NO2 — CID 138963169
7-tert-butyl-2,4-dimethyl-4-(2,2,2-trifluoroethyl)isoquinoline-1,3-dione (PubChem CID 138963169) has the molecular formula C17H20F3NO2 and a molecular weight of 327.35 g/mol. Its IUPAC name is 7-tert-butyl-2,4-dimethyl-4-(2,2,2-trifluoroethyl)isoquinoline-1,3-dione.
| Compound Name | 7-tert-butyl-2,4-dimethyl-4-(2,2,2-trifluoroethyl)isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 138963169 |
| Molecular Formula | C17H20F3NO2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 7-tert-butyl-2,4-dimethyl-4-(2,2,2-trifluoroethyl)isoquinoline-1,3-dione |
| SMILES | CN1C(=O)c2cc(C(C)(C)C)ccc2C(C)(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C17H20F3NO2/c1-15(2,3)10-6-7-12-11(8-10)13(22)21(5)14(23)16(12,4)9-17(18,19)20/h6-8H,9H2,1-5H3 |
| InChIKey | DHLATQDVMJHBDG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|