About CID 138963218
CID 138963218 (PubChem CID 138963218) has the molecular formula C20H11Br4O5
and a molecular weight of 650.92 g/mol.
Molecular Properties
| Compound Name | CID 138963218 |
| PubChem CID | 138963218 |
| Molecular Formula | C20H11Br4O5 |
| Molecular Weight | 650.92 g/mol |
| Exact Mass | 646.73 |
| IUPAC Name | — |
| SMILES | O=C(O)c1ccccc1[C]1c2cc(Br)c(O)c(Br)c2OC2C(Br)=C(O)C(Br)=CC12 |
| InChI | InChI=1S/C20H11Br4O5/c21-11-5-9-13(7-3-1-2-4-8(7)20(27)28)10-6-12(22)17(26)15(24)19(10)29-18(9)14(23)16(11)25/h1-6,9,18,25-26H,(H,27,28) |
| InChIKey | VEIBHYKQHKSBPH-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 650.92 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 138963218 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 138963218?
The IUPAC name of CID 138963218 (CID 138963218) is not available.
What is the SMILES notation for CID 138963218?
The canonical SMILES for CID 138963218 is O=C(O)c1ccccc1[C]1c2cc(Br)c(O)c(Br)c2OC2C(Br)=C(O)C(Br)=CC12.
What is the InChIKey of CID 138963218?
The InChIKey is VEIBHYKQHKSBPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H11Br4O5/c21-11-5-9-13(7-3-1-2-4-8(7)20(27)28)10-6-12(22)17(26)15(24)19(10)29-18(9)14(23)16(11)25/h1-6,9,18,25-26H,(H,27,28).
What are the key properties of CID 138963218?
CID 138963218 has a molecular weight of 650.92 g/mol, XLogP of 6.42, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 138963218 is sourced from PubChem (CID 138963218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).