C20H15FN6O — CID 138963269
5-[4-(6-fluoro-3-pyridinyl)-3-(6-methoxy-3-pyridinyl)-2-pyridinyl]pyrimidin-2-amine (PubChem CID 138963269) has the molecular formula C20H15FN6O and a molecular weight of 374.38 g/mol. Its IUPAC name is 5-[4-(6-fluoro-3-pyridinyl)-3-(6-methoxy-3-pyridinyl)-2-pyridinyl]pyrimidin-2-amine.
| Compound Name | 5-[4-(6-fluoro-3-pyridinyl)-3-(6-methoxy-3-pyridinyl)-2-pyridinyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 138963269 |
| Molecular Formula | C20H15FN6O |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 5-[4-(6-fluoro-3-pyridinyl)-3-(6-methoxy-3-pyridinyl)-2-pyridinyl]pyrimidin-2-amine |
| SMILES | COc1ccc(-c2c(-c3ccc(F)nc3)ccnc2-c2cnc(N)nc2)cn1 |
| InChI | InChI=1S/C20H15FN6O/c1-28-17-5-3-13(9-25-17)18-15(12-2-4-16(21)24-8-12)6-7-23-19(18)14-10-26-20(22)27-11-14/h2-11H,1H3,(H2,22,26,27) |
| InChIKey | WIATYYMEVYFVME-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|