C23H24O4 — CID 138963306
5,5'-dihydroxy-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-4,4'-dicarbaldehyde (PubChem CID 138963306) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is 5,5'-dihydroxy-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-4,4'-dicarbaldehyde.
| Compound Name | 5,5'-dihydroxy-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-4,4'-dicarbaldehyde |
|---|---|
| PubChem CID | 138963306 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 5,5'-dihydroxy-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-4,4'-dicarbaldehyde |
| SMILES | CC1(C)CC2(CC(C)(C)c3ccc(O)c(C=O)c32)c2c1ccc(O)c2C=O |
| InChI | InChI=1S/C23H24O4/c1-21(2)11-23(19-13(9-24)17(26)7-5-15(19)21)12-22(3,4)16-6-8-18(27)14(10-25)20(16)23/h5-10,26-27H,11-12H2,1-4H3 |
| InChIKey | UYCAWNRTNFKAOH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|