C25H22F6O8S2 — CID 138963309
[4,4'-diformyl-1,1,1',1'-tetramethyl-5'-(trifluoromethylsulfonyloxy)-3,3'-spirobi[2H-indene]-5-yl] trifluoromethanesulfonate (PubChem CID 138963309) has the molecular formula C25H22F6O8S2 and a molecular weight of 628.57 g/mol. Its IUPAC name is [4,4'-diformyl-1,1,1',1'-tetramethyl-5'-(trifluoromethylsulfonyloxy)-3,3'-spirobi[2H-indene]-5-yl] trifluoromethanesulfonate.
| Compound Name | [4,4'-diformyl-1,1,1',1'-tetramethyl-5'-(trifluoromethylsulfonyloxy)-3,3'-spirobi[2H-indene]-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 138963309 |
| Molecular Formula | C25H22F6O8S2 |
| Molecular Weight | 628.57 g/mol |
| Exact Mass | 628.07 |
| IUPAC Name | [4,4'-diformyl-1,1,1',1'-tetramethyl-5'-(trifluoromethylsulfonyloxy)-3,3'-spirobi[2H-indene]-5-yl] trifluoromethanesulfonate |
| SMILES | CC1(C)CC2(CC(C)(C)c3ccc(OS(=O)(=O)C(F)(F)F)c(C=O)c32)c2c1ccc(OS(=O)(=O)C(F)(F)F)c2C=O |
| InChI | InChI=1S/C25H22F6O8S2/c1-21(2)11-23(19-13(9-32)17(7-5-15(19)21)38-40(34,35)24(26,27)28)12-22(3,4)16-6-8-18(14(10-33)20(16)23)39-41(36,37)25(29,30)31/h5-10H,11-12H2,1-4H3 |
| InChIKey | JPIFCSVKXXPNLG-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|