C13H23N5O2 — CID 138963613
1-(5-aminohexyl)-3,7-dimethyl-4,5-dihydropurine-2,6-dione (PubChem CID 138963613) has the molecular formula C13H23N5O2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-(5-aminohexyl)-3,7-dimethyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 1-(5-aminohexyl)-3,7-dimethyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 138963613 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 1-(5-aminohexyl)-3,7-dimethyl-4,5-dihydropurine-2,6-dione |
| SMILES | CC(N)CCCCN1C(=O)C2C(N=CN2C)N(C)C1=O |
| InChI | InChI=1S/C13H23N5O2/c1-9(14)6-4-5-7-18-12(19)10-11(15-8-16(10)2)17(3)13(18)20/h8-11H,4-7,14H2,1-3H3 |
| InChIKey | QGXORVYCZRPRGK-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 82.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|