C28H44O4 — CID 138963629
(1R,2S,4R,6S,9S,11S,12R,15R,16R)-15-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-6,11-dihydroxy-9,16-dimethyl-3-oxapentacyclo[9.7.0.02,4.04,9.012,16]octadecan-10-one (PubChem CID 138963629) has the molecular formula C28H44O4 and a molecular weight of 444.66 g/mol. Its IUPAC name is (1R,2S,4R,6S,9S,11S,12R,15R,16R)-15-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-6,11-dihydroxy-9,16-dimethyl-3-oxapentacyclo[9.7.0.02,4.04,9.012,16]octadecan-10-one.
| Compound Name | (1R,2S,4R,6S,9S,11S,12R,15R,16R)-15-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-6,11-dihydroxy-9,16-dimethyl-3-oxapentacyclo[9.7.0.02,4.04,9.012,16]octadecan-10-one |
|---|---|
| PubChem CID | 138963629 |
| Molecular Formula | C28H44O4 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | (1R,2S,4R,6S,9S,11S,12R,15R,16R)-15-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-6,11-dihydroxy-9,16-dimethyl-3-oxapentacyclo[9.7.0.02,4.04,9.012,16]octadecan-10-one |
| SMILES | CC(C)[C@@H](C)/C=C/[C@@H](C)[C@H]1CC[C@@H]2[C@]1(C)CC[C@@H]1[C@@H]3O[C@@]34C[C@@H](O)CC[C@]4(C)C(=O)[C@@]12O |
| InChI | InChI=1S/C28H44O4/c1-16(2)17(3)7-8-18(4)20-9-10-22-25(20,5)13-12-21-23-27(32-23)15-19(29)11-14-26(27,6)24(30)28(21,22)31/h7-8,16-23,29,31H,9-15H2,1-6H3/b8-7+/t17-,18+,19-,20+,21+,22+,23-,25+,26+,27-,28+/m0/s1 |
| InChIKey | BHDMCKRBTNLIGX-RJLSYHOWSA-N |
| XLogP | 4.92 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|