C17H29IO2 — CID 138963664
2-[(2E,6E)-10-iodo-3,7-dimethyldeca-2,6-dienoxy]oxane (PubChem CID 138963664) has the molecular formula C17H29IO2 and a molecular weight of 392.32 g/mol. Its IUPAC name is 2-[(2E,6E)-10-iodo-3,7-dimethyldeca-2,6-dienoxy]oxane.
| Compound Name | 2-[(2E,6E)-10-iodo-3,7-dimethyldeca-2,6-dienoxy]oxane |
|---|---|
| PubChem CID | 138963664 |
| Molecular Formula | C17H29IO2 |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 2-[(2E,6E)-10-iodo-3,7-dimethyldeca-2,6-dienoxy]oxane |
| SMILES | C/C(=C\COC1CCCCO1)CC/C=C(\C)CCCI |
| InChI | InChI=1S/C17H29IO2/c1-15(9-6-12-18)7-5-8-16(2)11-14-20-17-10-3-4-13-19-17/h7,11,17H,3-6,8-10,12-14H2,1-2H3/b15-7+,16-11+ |
| InChIKey | JETKJONMHGZVLJ-MNBXHXLRSA-N |
| XLogP | 5.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|