C18H26O2 — CID 138963670
(5S,8aS)-5,8a-dimethyl-5-(4-methylpent-3-enyl)-2,3,7,8-tetrahydronaphthalene-1,6-dione (PubChem CID 138963670) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (5S,8aS)-5,8a-dimethyl-5-(4-methylpent-3-enyl)-2,3,7,8-tetrahydronaphthalene-1,6-dione.
| Compound Name | (5S,8aS)-5,8a-dimethyl-5-(4-methylpent-3-enyl)-2,3,7,8-tetrahydronaphthalene-1,6-dione |
|---|---|
| PubChem CID | 138963670 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (5S,8aS)-5,8a-dimethyl-5-(4-methylpent-3-enyl)-2,3,7,8-tetrahydronaphthalene-1,6-dione |
| SMILES | CC(C)=CCC[C@]1(C)C(=O)CC[C@]2(C)C(=O)CCC=C12 |
| InChI | InChI=1S/C18H26O2/c1-13(2)7-6-11-17(3)14-8-5-9-15(19)18(14,4)12-10-16(17)20/h7-8H,5-6,9-12H2,1-4H3/t17-,18-/m0/s1 |
| InChIKey | NDOGPRQLWQVFJZ-ROUUACIJSA-N |
| XLogP | 4.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|