C28H22Br2O4S2 — CID 138963749
dimethyl 13,15-bis(5-bromothiophen-2-yl)tricyclo[8.2.2.24,7]hexadeca-1(13),4(16),5,7(15),10(14),11-hexaene-5,11-dicarboxylate (PubChem CID 138963749) has the molecular formula C28H22Br2O4S2 and a molecular weight of 646.42 g/mol. Its IUPAC name is dimethyl 13,15-bis(5-bromothiophen-2-yl)tricyclo[8.2.2.24,7]hexadeca-1(13),4(16),5,7(15),10(14),11-hexaene-5,11-dicarboxylate.
| Compound Name | dimethyl 13,15-bis(5-bromothiophen-2-yl)tricyclo[8.2.2.24,7]hexadeca-1(13),4(16),5,7(15),10(14),11-hexaene-5,11-dicarboxylate |
|---|---|
| PubChem CID | 138963749 |
| Molecular Formula | C28H22Br2O4S2 |
| Molecular Weight | 646.42 g/mol |
| Exact Mass | 643.93 |
| IUPAC Name | dimethyl 13,15-bis(5-bromothiophen-2-yl)tricyclo[8.2.2.24,7]hexadeca-1(13),4(16),5,7(15),10(14),11-hexaene-5,11-dicarboxylate |
| SMILES | COC(=O)c1cc2c(-c3ccc(Br)s3)cc1CCc1cc(C(=O)OC)c(cc1-c1ccc(Br)s1)CC2 |
| InChI | InChI=1S/C28H22Br2O4S2/c1-33-27(31)21-13-15-4-6-18-12-20(24-8-10-26(30)36-24)16(14-22(18)28(32)34-2)3-5-17(21)11-19(15)23-7-9-25(29)35-23/h7-14H,3-6H2,1-2H3 |
| InChIKey | SARYXIGJEBNBQG-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.42 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |