C15H21NO4 — CID 138963820
(2S)-2-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3,3-dimethylbutanoic acid (PubChem CID 138963820) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is (2S)-2-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 138963820 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | (2S)-2-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@@H](C(=O)O)N1C(=O)[C@@H]2[C@@H]3CC[C@@H](C3)[C@@H]2C1=O |
| InChI | InChI=1S/C15H21NO4/c1-15(2,3)11(14(19)20)16-12(17)9-7-4-5-8(6-7)10(9)13(16)18/h7-11H,4-6H2,1-3H3,(H,19,20)/t7-,8+,9-,10+,11-/m1/s1 |
| InChIKey | HSZSWONHRSJNJU-NZHYYXIDSA-N |
| XLogP | 1.52 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|