C42H39NO3S — CID 138964027
(1R)-1-methyl-5-(4-methylphenyl)sulfonyl-22-phenylmethoxy-5-azaheptacyclo[14.12.0.02,14.04,12.06,11.017,26.020,25]octacosa-2,4(12),6,8,10,13,20(25),21,23-nonaene (PubChem CID 138964027) has the molecular formula C42H39NO3S and a molecular weight of 637.85 g/mol. Its IUPAC name is (1R)-1-methyl-5-(4-methylphenyl)sulfonyl-22-phenylmethoxy-5-azaheptacyclo[14.12.0.02,14.04,12.06,11.017,26.020,25]octacosa-2,4(12),6,8,10,13,20(25),21,23-nonaene.
| Compound Name | (1R)-1-methyl-5-(4-methylphenyl)sulfonyl-22-phenylmethoxy-5-azaheptacyclo[14.12.0.02,14.04,12.06,11.017,26.020,25]octacosa-2,4(12),6,8,10,13,20(25),21,23-nonaene |
|---|---|
| PubChem CID | 138964027 |
| Molecular Formula | C42H39NO3S |
| Molecular Weight | 637.85 g/mol |
| Exact Mass | 637.27 |
| IUPAC Name | (1R)-1-methyl-5-(4-methylphenyl)sulfonyl-22-phenylmethoxy-5-azaheptacyclo[14.12.0.02,14.04,12.06,11.017,26.020,25]octacosa-2,4(12),6,8,10,13,20(25),21,23-nonaene |
| SMILES | Cc1ccc(S(=O)(=O)n2c3ccccc3c3cc4c(cc32)[C@]2(C)CCC3c5ccc(OCc6ccccc6)cc5CCC3C2C4)cc1 |
| InChI | InChI=1S/C42H39NO3S/c1-27-12-16-32(17-13-27)47(44,45)43-40-11-7-6-10-36(40)37-23-30-24-39-35-18-14-29-22-31(46-26-28-8-4-3-5-9-28)15-19-33(29)34(35)20-21-42(39,2)38(30)25-41(37)43/h3-13,15-17,19,22-23,25,34-35,39H,14,18,20-21,24,26H2,1-2H3/t34?,35?,39?,42-/m0/s1 |
| InChIKey | PEHVOHCNODMWGI-ZRCJMAFRSA-N |
| XLogP | 9.49 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.85 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |