C16H22O3 — CID 138964087
(1R,7S,9R,10S,11R)-3-methoxy-10,11-dimethyl-9-prop-1-en-2-yl-2-oxatricyclo[5.3.1.04,11]undec-4-en-6-one (PubChem CID 138964087) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (1R,7S,9R,10S,11R)-3-methoxy-10,11-dimethyl-9-prop-1-en-2-yl-2-oxatricyclo[5.3.1.04,11]undec-4-en-6-one.
| Compound Name | (1R,7S,9R,10S,11R)-3-methoxy-10,11-dimethyl-9-prop-1-en-2-yl-2-oxatricyclo[5.3.1.04,11]undec-4-en-6-one |
|---|---|
| PubChem CID | 138964087 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (1R,7S,9R,10S,11R)-3-methoxy-10,11-dimethyl-9-prop-1-en-2-yl-2-oxatricyclo[5.3.1.04,11]undec-4-en-6-one |
| SMILES | C=C(C)[C@@H]1C[C@@H]2C(=O)C=C3C(OC)O[C@H]([C@H]1C)[C@@]32C |
| InChI | InChI=1S/C16H22O3/c1-8(2)10-6-11-13(17)7-12-15(18-5)19-14(9(10)3)16(11,12)4/h7,9-11,14-15H,1,6H2,2-5H3/t9-,10-,11+,14+,15?,16+/m0/s1 |
| InChIKey | JURLCRGGWCRDRF-HFOOKYCNSA-N |
| XLogP | 2.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|